C17H30N2O5 — CID 122023417
4-[3-(oxan-4-ylmethoxy)propylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122023417) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-[3-(oxan-4-ylmethoxy)propylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-(oxan-4-ylmethoxy)propylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122023417 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-[3-(oxan-4-ylmethoxy)propylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCCCOCC1CCOCC1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H30N2O5/c20-16(21)14-2-4-15(5-3-14)19-17(22)18-8-1-9-24-12-13-6-10-23-11-7-13/h13-15H,1-12H2,(H,20,21)(H2,18,19,22) |
| InChIKey | VLGWJWCMBKXTLK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|