C18H32N2O3 — CID 97080306
1-[(1S,2S)-2-cyclohexylcyclopropyl]-3-[3-[[(3R)-oxolan-3-yl]methoxy]propyl]urea (PubChem CID 97080306) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[(1S,2S)-2-cyclohexylcyclopropyl]-3-[3-[[(3R)-oxolan-3-yl]methoxy]propyl]urea.
| Compound Name | 1-[(1S,2S)-2-cyclohexylcyclopropyl]-3-[3-[[(3R)-oxolan-3-yl]methoxy]propyl]urea |
|---|---|
| PubChem CID | 97080306 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 1-[(1S,2S)-2-cyclohexylcyclopropyl]-3-[3-[[(3R)-oxolan-3-yl]methoxy]propyl]urea |
| SMILES | O=C(NCCCOC[C@@H]1CCOC1)N[C@H]1C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C18H32N2O3/c21-18(19-8-4-9-22-12-14-7-10-23-13-14)20-17-11-16(17)15-5-2-1-3-6-15/h14-17H,1-13H2,(H2,19,20,21)/t14-,16-,17-/m0/s1 |
| InChIKey | VSELFXUSIJNXFR-XIRDDKMYSA-N |
| XLogP | 2.70 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|