C13H27ClN2O3 — CID 120501461
3-amino-2-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]butanamide;hydrochloride (PubChem CID 120501461) has the molecular formula C13H27ClN2O3 and a molecular weight of 294.82 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]butanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120501461 |
| Molecular Formula | C13H27ClN2O3 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-amino-2-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]butanamide;hydrochloride |
| SMILES | CC(N)C(C)C(=O)NCCCOCC1CCOC1.Cl |
| InChI | InChI=1S/C13H26N2O3.ClH/c1-10(11(2)14)13(16)15-5-3-6-17-8-12-4-7-18-9-12;/h10-12H,3-9,14H2,1-2H3,(H,15,16);1H |
| InChIKey | NSOPUMVDLAOULG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|