C10H18ClN3O2 — CID 119726704
3-amino-N-(2-amino-2-oxoethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119726704) has the molecular formula C10H18ClN3O2 and a molecular weight of 247.73 g/mol. Its IUPAC name is 3-amino-N-(2-amino-2-oxoethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(2-amino-2-oxoethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119726704 |
| Molecular Formula | C10H18ClN3O2 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-amino-N-(2-amino-2-oxoethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)CNC(=O)C1C2CCC(C2)C1N |
| InChI | InChI=1S/C10H17N3O2.ClH/c11-7(14)4-13-10(15)8-5-1-2-6(3-5)9(8)12;/h5-6,8-9H,1-4,12H2,(H2,11,14)(H,13,15);1H |
| InChIKey | VAOGOENQPSYFJZ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |