C21H26N2O — CID 119335236
1-amino-N-(2,3-diphenylpropyl)cyclopentane-1-carboxamide (PubChem CID 119335236) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-amino-N-(2,3-diphenylpropyl)cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-(2,3-diphenylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119335236 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-amino-N-(2,3-diphenylpropyl)cyclopentane-1-carboxamide |
| SMILES | NC1(C(=O)NCC(Cc2ccccc2)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H26N2O/c22-21(13-7-8-14-21)20(24)23-16-19(18-11-5-2-6-12-18)15-17-9-3-1-4-10-17/h1-6,9-12,19H,7-8,13-16,22H2,(H,23,24) |
| InChIKey | SZDZRXKGJXDBMQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |