C14H22N2O2 — CID 11933626
ethyl (2R)-2-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]iminopropanoate (PubChem CID 11933626) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethyl (2R)-2-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]iminopropanoate.
| Compound Name | ethyl (2R)-2-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]iminopropanoate |
|---|---|
| PubChem CID | 11933626 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethyl (2R)-2-cyano-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]iminopropanoate |
| SMILES | CCOC(=O)[C@@H](C#N)/C=N/[C@@H]1CCC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C14H22N2O2/c1-4-18-14(17)12(8-15)9-16-13-7-5-6-10(2)11(13)3/h9-13H,4-7H2,1-3H3/b16-9+/t10-,11-,12-,13+/m0/s1 |
| InChIKey | LPZOIGFIWYEGIG-AQZDREDISA-N |
| XLogP | 2.58 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|