C13H20N2O2 — CID 11933630
ethyl (2R)-2-cyano-3-[(1S,2S)-2-methylcyclohexyl]iminopropanoate (PubChem CID 11933630) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is ethyl (2R)-2-cyano-3-[(1S,2S)-2-methylcyclohexyl]iminopropanoate.
| Compound Name | ethyl (2R)-2-cyano-3-[(1S,2S)-2-methylcyclohexyl]iminopropanoate |
|---|---|
| PubChem CID | 11933630 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | ethyl (2R)-2-cyano-3-[(1S,2S)-2-methylcyclohexyl]iminopropanoate |
| SMILES | CCOC(=O)[C@@H](C#N)/C=N/[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C13H20N2O2/c1-3-17-13(16)11(8-14)9-15-12-7-5-4-6-10(12)2/h9-12H,3-7H2,1-2H3/b15-9+/t10-,11-,12-/m0/s1 |
| InChIKey | AHCFOUVUIYMVBB-JKZHAPNDSA-N |
| XLogP | 2.34 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|