C21H17Cl2NO5 — CID 1193379
[4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 1193379) has the molecular formula C21H17Cl2NO5 and a molecular weight of 434.28 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 1193379 |
| Molecular Formula | C21H17Cl2NO5 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | [4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(OC(=O)c2ccc(Cl)cc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C21H17Cl2NO5/c1-3-27-19-10-13(9-14(12-24)20(25)28-4-2)5-8-18(19)29-21(26)16-7-6-15(22)11-17(16)23/h5-11H,3-4H2,1-2H3/b14-9+ |
| InChIKey | NLNFLIHGRHSJDF-NTEUORMPSA-N |
| XLogP | 5.08 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|