About 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide
1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 119338167) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide |
| PubChem CID | 119338167 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(N)CCCCC2)cc1-c1ncco1 |
| InChI | InChI=1S/C17H21N3O2/c1-12-5-6-13(11-14(12)15-19-9-10-22-15)20-16(21)17(18)7-3-2-4-8-17/h5-6,9-11H,2-4,7-8,18H2,1H3,(H,20,21) |
| InChIKey | LAJIXUWUJHKKMD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide?
The IUPAC name of 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide (CID 119338167) is 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide.
What is the SMILES notation for 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide?
The canonical SMILES for 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide is Cc1ccc(NC(=O)C2(N)CCCCC2)cc1-c1ncco1.
What is the InChIKey of 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide?
The InChIKey is LAJIXUWUJHKKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-12-5-6-13(11-14(12)15-19-9-10-22-15)20-16(21)17(18)7-3-2-4-8-17/h5-6,9-11H,2-4,7-8,18H2,1H3,(H,20,21).
What are the key properties of 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide?
1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide has a molecular weight of 299.37 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]cyclohexane-1-carboxamide is sourced from PubChem (CID 119338167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).