C15H19N3O3 — CID 119809308
2-(2-methoxyethylamino)-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]acetamide (PubChem CID 119809308) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]acetamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 119809308 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[4-methyl-3-(1,3-oxazol-2-yl)phenyl]acetamide |
| SMILES | COCCNCC(=O)Nc1ccc(C)c(-c2ncco2)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-11-3-4-12(9-13(11)15-17-6-8-21-15)18-14(19)10-16-5-7-20-2/h3-4,6,8-9,16H,5,7,10H2,1-2H3,(H,18,19) |
| InChIKey | VUPBXNIIDGEVHU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|