C13H25ClN2O3 — CID 119338471
propan-2-yl 2-methyl-3-(piperidine-3-carbonylamino)propanoate;hydrochloride (PubChem CID 119338471) has the molecular formula C13H25ClN2O3 and a molecular weight of 292.81 g/mol. Its IUPAC name is propan-2-yl 2-methyl-3-(piperidine-3-carbonylamino)propanoate;hydrochloride.
| Compound Name | propan-2-yl 2-methyl-3-(piperidine-3-carbonylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119338471 |
| Molecular Formula | C13H25ClN2O3 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | propan-2-yl 2-methyl-3-(piperidine-3-carbonylamino)propanoate;hydrochloride |
| SMILES | CC(C)OC(=O)C(C)CNC(=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C13H24N2O3.ClH/c1-9(2)18-13(17)10(3)7-15-12(16)11-5-4-6-14-8-11;/h9-11,14H,4-8H2,1-3H3,(H,15,16);1H |
| InChIKey | RZSVCMXZEZYZDK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |