C12H23ClN2O3 — CID 119338461
propan-2-yl 2-methyl-3-(pyrrolidine-2-carbonylamino)propanoate;hydrochloride (PubChem CID 119338461) has the molecular formula C12H23ClN2O3 and a molecular weight of 278.78 g/mol. Its IUPAC name is propan-2-yl 2-methyl-3-(pyrrolidine-2-carbonylamino)propanoate;hydrochloride.
| Compound Name | propan-2-yl 2-methyl-3-(pyrrolidine-2-carbonylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119338461 |
| Molecular Formula | C12H23ClN2O3 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | propan-2-yl 2-methyl-3-(pyrrolidine-2-carbonylamino)propanoate;hydrochloride |
| SMILES | CC(C)OC(=O)C(C)CNC(=O)C1CCCN1.Cl |
| InChI | InChI=1S/C12H22N2O3.ClH/c1-8(2)17-12(16)9(3)7-14-11(15)10-5-4-6-13-10;/h8-10,13H,4-7H2,1-3H3,(H,14,15);1H |
| InChIKey | RDCUZAQYCKAANV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |