C18H28N2O3 — CID 119339437
N-[[2-(2-ethoxyethoxy)-4-methylphenyl]methyl]piperidine-3-carboxamide (PubChem CID 119339437) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[[2-(2-ethoxyethoxy)-4-methylphenyl]methyl]piperidine-3-carboxamide.
| Compound Name | N-[[2-(2-ethoxyethoxy)-4-methylphenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119339437 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[[2-(2-ethoxyethoxy)-4-methylphenyl]methyl]piperidine-3-carboxamide |
| SMILES | CCOCCOc1cc(C)ccc1CNC(=O)C1CCCNC1 |
| InChI | InChI=1S/C18H28N2O3/c1-3-22-9-10-23-17-11-14(2)6-7-15(17)13-20-18(21)16-5-4-8-19-12-16/h6-7,11,16,19H,3-5,8-10,12-13H2,1-2H3,(H,20,21) |
| InChIKey | CHLXGYXMMKTPFN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|