C20H30N2O5 — CID 122005886
4-[[2-(2-ethoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122005886) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[[2-(2-ethoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(2-ethoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122005886 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-[[2-(2-ethoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CCOCCOc1cc(C)ccc1CNC(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C20H30N2O5/c1-3-26-10-11-27-18-12-14(2)4-5-16(18)13-21-20(25)22-17-8-6-15(7-9-17)19(23)24/h4-5,12,15,17H,3,6-11,13H2,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | ISKQJKLGRPHEHV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|