C19H28N2O5 — CID 122005941
4-[[2-(2-methoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122005941) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[[2-(2-methoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(2-methoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122005941 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-[[2-(2-methoxyethoxy)-4-methylphenyl]methylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | COCCOc1cc(C)ccc1CNC(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C19H28N2O5/c1-13-3-4-15(17(11-13)26-10-9-25-2)12-20-19(24)21-16-7-5-14(6-8-16)18(22)23/h3-4,11,14,16H,5-10,12H2,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | TYOGTUQKVAQSKK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|