C13H26ClN3O3S — CID 119341231
2-amino-N-(1-cyclopropylsulfonylpiperidin-4-yl)pentanamide;hydrochloride (PubChem CID 119341231) has the molecular formula C13H26ClN3O3S and a molecular weight of 339.89 g/mol. Its IUPAC name is 2-amino-N-(1-cyclopropylsulfonylpiperidin-4-yl)pentanamide;hydrochloride.
| Compound Name | 2-amino-N-(1-cyclopropylsulfonylpiperidin-4-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119341231 |
| Molecular Formula | C13H26ClN3O3S |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-amino-N-(1-cyclopropylsulfonylpiperidin-4-yl)pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)NC1CCN(S(=O)(=O)C2CC2)CC1.Cl |
| InChI | InChI=1S/C13H25N3O3S.ClH/c1-2-3-12(14)13(17)15-10-6-8-16(9-7-10)20(18,19)11-4-5-11;/h10-12H,2-9,14H2,1H3,(H,15,17);1H |
| InChIKey | YDULQPSCPLHXRT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |