C12H25N3O3S — CID 56865366
(2R)-2-amino-4-methyl-N-(1-methylsulfonylpiperidin-4-yl)pentanamide (PubChem CID 56865366) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-N-(1-methylsulfonylpiperidin-4-yl)pentanamide.
| Compound Name | (2R)-2-amino-4-methyl-N-(1-methylsulfonylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 56865366 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2R)-2-amino-4-methyl-N-(1-methylsulfonylpiperidin-4-yl)pentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)NC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H25N3O3S/c1-9(2)8-11(13)12(16)14-10-4-6-15(7-5-10)19(3,17)18/h9-11H,4-8,13H2,1-3H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | VVYKIYDKUZCOSL-LLVKDONJSA-N |
| XLogP | -0.10 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |