C14H27N3O4S — CID 69308058
(2S)-2-amino-N-(1-ethylsulfonyl-3-oxoazepan-4-yl)-4-methylpentanamide (PubChem CID 69308058) has the molecular formula C14H27N3O4S and a molecular weight of 333.45 g/mol. Its IUPAC name is (2S)-2-amino-N-(1-ethylsulfonyl-3-oxoazepan-4-yl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(1-ethylsulfonyl-3-oxoazepan-4-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 69308058 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2S)-2-amino-N-(1-ethylsulfonyl-3-oxoazepan-4-yl)-4-methylpentanamide |
| SMILES | CCS(=O)(=O)N1CCCC(NC(=O)[C@@H](N)CC(C)C)C(=O)C1 |
| InChI | InChI=1S/C14H27N3O4S/c1-4-22(20,21)17-7-5-6-12(13(18)9-17)16-14(19)11(15)8-10(2)3/h10-12H,4-9,15H2,1-3H3,(H,16,19)/t11-,12?/m0/s1 |
| InChIKey | YAEDTUJDAJKEEM-PXYINDEMSA-N |
| XLogP | -0.14 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |