C22H33ClN2O2 — CID 119341886
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119341886) has the molecular formula C22H33ClN2O2 and a molecular weight of 392.97 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119341886 |
| Molecular Formula | C22H33ClN2O2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(C1CC2CCCCC2N1)N1CCC(OCCCc2ccccc2)C1 |
| InChI | InChI=1S/C22H32N2O2.ClH/c25-22(21-15-18-10-4-5-11-20(18)23-21)24-13-12-19(16-24)26-14-6-9-17-7-2-1-3-8-17;/h1-3,7-8,18-21,23H,4-6,9-16H2;1H |
| InChIKey | ZDJWOAQOSXKLEE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|