C12H17N3O3 — CID 119343567
N-[(5-carbamoylfuran-2-yl)methyl]piperidine-2-carboxamide (PubChem CID 119343567) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[(5-carbamoylfuran-2-yl)methyl]piperidine-2-carboxamide.
| Compound Name | N-[(5-carbamoylfuran-2-yl)methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119343567 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[(5-carbamoylfuran-2-yl)methyl]piperidine-2-carboxamide |
| SMILES | NC(=O)c1ccc(CNC(=O)C2CCCCN2)o1 |
| InChI | InChI=1S/C12H17N3O3/c13-11(16)10-5-4-8(18-10)7-15-12(17)9-3-1-2-6-14-9/h4-5,9,14H,1-3,6-7H2,(H2,13,16)(H,15,17) |
| InChIKey | FWPLFDOKMULDLF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |