C15H19F3N2O2S — CID 119344747
N-[2-[2-(trifluoromethyl)phenoxy]butyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119344747) has the molecular formula C15H19F3N2O2S and a molecular weight of 348.39 g/mol. Its IUPAC name is N-[2-[2-(trifluoromethyl)phenoxy]butyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[2-[2-(trifluoromethyl)phenoxy]butyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119344747 |
| Molecular Formula | C15H19F3N2O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[2-[2-(trifluoromethyl)phenoxy]butyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CCC(CNC(=O)C1CSCN1)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O2S/c1-2-10(7-19-14(21)12-8-23-9-20-12)22-13-6-4-3-5-11(13)15(16,17)18/h3-6,10,12,20H,2,7-9H2,1H3,(H,19,21) |
| InChIKey | OHVUPLFYCFMLKQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |