C16H24N2OS — CID 119337615
N-(2-ethyl-2-phenylbutyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 119337615) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-(2-ethyl-2-phenylbutyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-ethyl-2-phenylbutyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119337615 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(2-ethyl-2-phenylbutyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCC(CC)(CNC(=O)C1CSCN1)c1ccccc1 |
| InChI | InChI=1S/C16H24N2OS/c1-3-16(4-2,13-8-6-5-7-9-13)11-17-15(19)14-10-20-12-18-14/h5-9,14,18H,3-4,10-12H2,1-2H3,(H,17,19) |
| InChIKey | DWUVXWZIJQGLMS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |