C14H18N2O6 — CID 119346726
2-[[3-methoxy-4-[2-(methylamino)-2-oxoethoxy]benzoyl]-methylamino]acetic acid (PubChem CID 119346726) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-[[3-methoxy-4-[2-(methylamino)-2-oxoethoxy]benzoyl]-methylamino]acetic acid.
| Compound Name | 2-[[3-methoxy-4-[2-(methylamino)-2-oxoethoxy]benzoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 119346726 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[[3-methoxy-4-[2-(methylamino)-2-oxoethoxy]benzoyl]-methylamino]acetic acid |
| SMILES | CNC(=O)COc1ccc(C(=O)N(C)CC(=O)O)cc1OC |
| InChI | InChI=1S/C14H18N2O6/c1-15-12(17)8-22-10-5-4-9(6-11(10)21-3)14(20)16(2)7-13(18)19/h4-6H,7-8H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | WWHDRZGAUSCJBY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |