C16H23NO5 — CID 119348002
2-[2-methoxyethyl-[3-(4-methoxyphenyl)butanoyl]amino]acetic acid (PubChem CID 119348002) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-[2-methoxyethyl-[3-(4-methoxyphenyl)butanoyl]amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl-[3-(4-methoxyphenyl)butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119348002 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[2-methoxyethyl-[3-(4-methoxyphenyl)butanoyl]amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)CC(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H23NO5/c1-12(13-4-6-14(22-3)7-5-13)10-15(18)17(8-9-21-2)11-16(19)20/h4-7,12H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | LKPQWLPRNDNPPX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |