C18H19N3O5S — CID 119349414
1-[4-(pyridin-4-ylsulfamoyl)benzoyl]piperidine-4-carboxylic acid (PubChem CID 119349414) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is 1-[4-(pyridin-4-ylsulfamoyl)benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-(pyridin-4-ylsulfamoyl)benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119349414 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-[4-(pyridin-4-ylsulfamoyl)benzoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2ccc(S(=O)(=O)Nc3ccncc3)cc2)CC1 |
| InChI | InChI=1S/C18H19N3O5S/c22-17(21-11-7-14(8-12-21)18(23)24)13-1-3-16(4-2-13)27(25,26)20-15-5-9-19-10-6-15/h1-6,9-10,14H,7-8,11-12H2,(H,19,20)(H,23,24) |
| InChIKey | KKDSLTOXGSHQPE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |