C25H26N4O4S — CID 55813137
N-(4-methyl-2-pyridinyl)-1-[4-(phenylsulfamoyl)benzoyl]piperidine-4-carboxamide (PubChem CID 55813137) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-1-[4-(phenylsulfamoyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-(4-methyl-2-pyridinyl)-1-[4-(phenylsulfamoyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55813137 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-1-[4-(phenylsulfamoyl)benzoyl]piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(C(=O)c3ccc(S(=O)(=O)Nc4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C25H26N4O4S/c1-18-11-14-26-23(17-18)27-24(30)19-12-15-29(16-13-19)25(31)20-7-9-22(10-8-20)34(32,33)28-21-5-3-2-4-6-21/h2-11,14,17,19,28H,12-13,15-16H2,1H3,(H,26,27,30) |
| InChIKey | OLSBRDFQKIJYCP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |