C20H21ClN2O4 — CID 119351920
2-[3-[[2-chloro-5-(3-methylbutanoylamino)benzoyl]amino]phenyl]acetic acid (PubChem CID 119351920) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-[3-[[2-chloro-5-(3-methylbutanoylamino)benzoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[2-chloro-5-(3-methylbutanoylamino)benzoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 119351920 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-[3-[[2-chloro-5-(3-methylbutanoylamino)benzoyl]amino]phenyl]acetic acid |
| SMILES | CC(C)CC(=O)Nc1ccc(Cl)c(C(=O)Nc2cccc(CC(=O)O)c2)c1 |
| InChI | InChI=1S/C20H21ClN2O4/c1-12(2)8-18(24)22-15-6-7-17(21)16(11-15)20(27)23-14-5-3-4-13(9-14)10-19(25)26/h3-7,9,11-12H,8,10H2,1-2H3,(H,22,24)(H,23,27)(H,25,26) |
| InChIKey | VOPSYOVQBODDKV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |