C14H17ClN2O4 — CID 62965912
5-[4-chloro-3-(methylcarbamoyl)anilino]-3-methyl-5-oxopentanoic acid (PubChem CID 62965912) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is 5-[4-chloro-3-(methylcarbamoyl)anilino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[4-chloro-3-(methylcarbamoyl)anilino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62965912 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-[4-chloro-3-(methylcarbamoyl)anilino]-3-methyl-5-oxopentanoic acid |
| SMILES | CNC(=O)c1cc(NC(=O)CC(C)CC(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H17ClN2O4/c1-8(6-13(19)20)5-12(18)17-9-3-4-11(15)10(7-9)14(21)16-2/h3-4,7-8H,5-6H2,1-2H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | FNJCUMLSQVWTFP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |