C12H14FNO3 — CID 2732332
5-(4-fluoroanilino)-3-methyl-5-oxopentanoic acid (PubChem CID 2732332) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 5-(4-fluoroanilino)-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-(4-fluoroanilino)-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 2732332 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 5-(4-fluoroanilino)-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FNO3/c1-8(7-12(16)17)6-11(15)14-10-4-2-9(13)3-5-10/h2-5,8H,6-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | ZHXFWLHEVUOFRR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |