C19H20F2N2O2 — CID 7432118
(3R)-N,N'-bis(4-fluorophenyl)-3-methylhexanediamide (PubChem CID 7432118) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is (3R)-N,N'-bis(4-fluorophenyl)-3-methylhexanediamide.
| Compound Name | (3R)-N,N'-bis(4-fluorophenyl)-3-methylhexanediamide |
|---|---|
| PubChem CID | 7432118 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (3R)-N,N'-bis(4-fluorophenyl)-3-methylhexanediamide |
| SMILES | C[C@H](CCC(=O)Nc1ccc(F)cc1)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20F2N2O2/c1-13(12-19(25)23-17-9-5-15(21)6-10-17)2-11-18(24)22-16-7-3-14(20)4-8-16/h3-10,13H,2,11-12H2,1H3,(H,22,24)(H,23,25)/t13-/m1/s1 |
| InChIKey | KOJKMUBHIZWCBP-CYBMUJFWSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |