C13H19N3O4 — CID 119352743
4-[(3,4-diethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]butanoic acid (PubChem CID 119352743) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-[(3,4-diethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(3,4-diethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119352743 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-[(3,4-diethyl-6-oxo-1H-pyridazine-5-carbonyl)amino]butanoic acid |
| SMILES | CCc1n[nH]c(=O)c(C(=O)NCCCC(=O)O)c1CC |
| InChI | InChI=1S/C13H19N3O4/c1-3-8-9(4-2)15-16-13(20)11(8)12(19)14-7-5-6-10(17)18/h3-7H2,1-2H3,(H,14,19)(H,16,20)(H,17,18) |
| InChIKey | UDNFXVHLZBKPSM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|