C12H12N4O5 — CID 119352749
4-[(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)amino]butanoic acid (PubChem CID 119352749) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119352749 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-[(2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C12H12N4O5/c17-8(18)2-1-3-13-10(19)6-4-7-9(14-5-6)15-12(21)16-11(7)20/h4-5H,1-3H2,(H,13,19)(H,17,18)(H2,14,15,16,20,21) |
| InChIKey | KFTRYUCIKXEKPZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 145.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|