C10H7N3O4 — CID 66966960
3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid (PubChem CID 66966960) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid.
| Compound Name | 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 66966960 |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C10H7N3O4/c14-7(15)2-1-5-3-6-8(11-4-5)12-10(17)13-9(6)16/h1-4H,(H,14,15)(H2,11,12,13,16,17) |
| InChIKey | CQKFDIJYJIIRQH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|