3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid

C10H7N3O4 — CID 66966960

IUPAC3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid
SMILESO=C(O)C=Cc1cnc2[nH]c(=O)[nH]c(=O)c2c1
InChIInChI=1S/C10H7N3O4/c14-7(15)2-1-5-3-6-8(11-4-5)12-10(17)13-9(6)16/h1-4H,(H,14,15)(H2,11,12,13,16,17)
InChIKeyCQKFDIJYJIIRQH-UHFFFAOYSA-N
MW233.18 g/mol
LogP-0.29
Rot. Bonds2

About 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid

3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid (PubChem CID 66966960) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid
PubChem CID66966960
Molecular FormulaC10H7N3O4
Molecular Weight233.18 g/mol
Exact Mass233.04
IUPAC Name3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid
SMILESO=C(O)C=Cc1cnc2[nH]c(=O)[nH]c(=O)c2c1
InChIInChI=1S/C10H7N3O4/c14-7(15)2-1-5-3-6-8(11-4-5)12-10(17)13-9(6)16/h1-4H,(H,14,15)(H2,11,12,13,16,17)
InChIKeyCQKFDIJYJIIRQH-UHFFFAOYSA-N
XLogP-0.29
TPSA115.91 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.18
LogP ≤ 5-0.29
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid?
The IUPAC name of 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid (CID 66966960) is 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid?
The canonical SMILES for 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid is O=C(O)C=Cc1cnc2[nH]c(=O)[nH]c(=O)c2c1.
What is the InChIKey of 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid?
The InChIKey is CQKFDIJYJIIRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O4/c14-7(15)2-1-5-3-6-8(11-4-5)12-10(17)13-9(6)16/h1-4H,(H,14,15)(H2,11,12,13,16,17).
What are the key properties of 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid?
3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid has a molecular weight of 233.18 g/mol, XLogP of -0.29, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enoic acid is sourced from PubChem (CID 66966960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).