C16H14N2O2 — CID 68851045
(E)-3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-6-yl)prop-2-enoic acid (PubChem CID 68851045) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is (E)-3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-6-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-6-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 68851045 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (E)-3-(3,8-dimethyl-9H-pyrido[2,3-b]indol-6-yl)prop-2-enoic acid |
| SMILES | Cc1cnc2[nH]c3c(C)cc(/C=C/C(=O)O)cc3c2c1 |
| InChI | InChI=1S/C16H14N2O2/c1-9-5-13-12-7-11(3-4-14(19)20)6-10(2)15(12)18-16(13)17-8-9/h3-8H,1-2H3,(H,17,18)(H,19,20)/b4-3+ |
| InChIKey | NRTDKMPBKQZBKH-ONEGZZNKSA-N |
| XLogP | 3.43 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|