C16H20Cl2N2O4 — CID 119352757
4-[[2-(2,4-dichlorophenyl)-2-morpholin-4-ylacetyl]amino]butanoic acid (PubChem CID 119352757) has the molecular formula C16H20Cl2N2O4 and a molecular weight of 375.25 g/mol. Its IUPAC name is 4-[[2-(2,4-dichlorophenyl)-2-morpholin-4-ylacetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(2,4-dichlorophenyl)-2-morpholin-4-ylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352757 |
| Molecular Formula | C16H20Cl2N2O4 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-[[2-(2,4-dichlorophenyl)-2-morpholin-4-ylacetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C(c1ccc(Cl)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C16H20Cl2N2O4/c17-11-3-4-12(13(18)10-11)15(20-6-8-24-9-7-20)16(23)19-5-1-2-14(21)22/h3-4,10,15H,1-2,5-9H2,(H,19,23)(H,21,22) |
| InChIKey | JKPMLNKETXCGGK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|