C22H35N2O3+ — CID 11935497
2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide (PubChem CID 11935497) has the molecular formula C22H35N2O3+ and a molecular weight of 375.53 g/mol. Its IUPAC name is 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11935497 |
| Molecular Formula | C22H35N2O3+ |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
| SMILES | CCOc1cc2c(cc1OCC)C[NH+](CC(=O)N[C@H]1CCCC[C@@H]1C)CC2 |
| InChI | InChI=1S/C22H34N2O3/c1-4-26-20-12-17-10-11-24(14-18(17)13-21(20)27-5-2)15-22(25)23-19-9-7-6-8-16(19)3/h12-13,16,19H,4-11,14-15H2,1-3H3,(H,23,25)/p+1/t16-,19-/m0/s1 |
| InChIKey | LOYRGMMYHWNJGK-LPHOPBHVSA-O |
| XLogP | 2.12 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |