C18H25F3N3O4+ — CID 8993426
2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 8993426) has the molecular formula C18H25F3N3O4+ and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8993426 |
| Molecular Formula | C18H25F3N3O4+ |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | CCOc1cc2c(cc1OCC)C[NH+](CC(=O)NC(=O)NCC(F)(F)F)CC2 |
| InChI | InChI=1S/C18H24F3N3O4/c1-3-27-14-7-12-5-6-24(9-13(12)8-15(14)28-4-2)10-16(25)23-17(26)22-11-18(19,20)21/h7-8H,3-6,9-11H2,1-2H3,(H2,22,23,25,26)/p+1 |
| InChIKey | GBGUQYVMWBXXAB-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |