C13H18F3N3O3 — CID 119358929
2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-methylamino]propanoic acid (PubChem CID 119358929) has the molecular formula C13H18F3N3O3 and a molecular weight of 321.30 g/mol. Its IUPAC name is 2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-methylamino]propanoic acid.
| Compound Name | 2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119358929 |
| Molecular Formula | C13H18F3N3O3 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[[1-tert-butyl-5-(trifluoromethyl)pyrazole-4-carbonyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)c1cnn(C(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O3/c1-7(11(21)22)18(5)10(20)8-6-17-19(12(2,3)4)9(8)13(14,15)16/h6-7H,1-5H3,(H,21,22) |
| InChIKey | YVMYQTHXUJLHNJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |