C16H27F3N4O — CID 51090894
1-tert-butyl-N-[3-[methyl(propan-2-yl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 51090894) has the molecular formula C16H27F3N4O and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-tert-butyl-N-[3-[methyl(propan-2-yl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[3-[methyl(propan-2-yl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 51090894 |
| Molecular Formula | C16H27F3N4O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-tert-butyl-N-[3-[methyl(propan-2-yl)amino]propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CC(C)N(C)CCCNC(=O)c1cnn(C(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C16H27F3N4O/c1-11(2)22(6)9-7-8-20-14(24)12-10-21-23(15(3,4)5)13(12)16(17,18)19/h10-11H,7-9H2,1-6H3,(H,20,24) |
| InChIKey | KCEQHHUYPOPZOZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|