C15H18ClN3O4 — CID 119359827
(2S)-2-[[2-chloro-5-(2-oxoimidazolidin-1-yl)benzoyl]amino]-3-methylbutanoic acid (PubChem CID 119359827) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-5-(2-oxoimidazolidin-1-yl)benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-chloro-5-(2-oxoimidazolidin-1-yl)benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119359827 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (2S)-2-[[2-chloro-5-(2-oxoimidazolidin-1-yl)benzoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1cc(N2CCNC2=O)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C15H18ClN3O4/c1-8(2)12(14(21)22)18-13(20)10-7-9(3-4-11(10)16)19-6-5-17-15(19)23/h3-4,7-8,12H,5-6H2,1-2H3,(H,17,23)(H,18,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | ULYQEQBACPAYPG-LBPRGKRZSA-N |
| XLogP | 1.71 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |