C14H19N3O5 — CID 119362434
3-[methyl-[2-[2-oxo-2-(pyridin-3-ylmethylamino)ethoxy]acetyl]amino]propanoic acid (PubChem CID 119362434) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-[methyl-[2-[2-oxo-2-(pyridin-3-ylmethylamino)ethoxy]acetyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-[2-oxo-2-(pyridin-3-ylmethylamino)ethoxy]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119362434 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-[methyl-[2-[2-oxo-2-(pyridin-3-ylmethylamino)ethoxy]acetyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)COCC(=O)NCc1cccnc1 |
| InChI | InChI=1S/C14H19N3O5/c1-17(6-4-14(20)21)13(19)10-22-9-12(18)16-8-11-3-2-5-15-7-11/h2-3,5,7H,4,6,8-10H2,1H3,(H,16,18)(H,20,21) |
| InChIKey | UIKRAZHACIOUBB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |