3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid

C14H19NO5 — CID 119362723

IUPAC3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid
SMILESCOc1cccc(OC)c1CC(=O)N(C)CCC(=O)O
InChIInChI=1S/C14H19NO5/c1-15(8-7-14(17)18)13(16)9-10-11(19-2)5-4-6-12(10)20-3/h4-6H,7-9H2,1-3H3,(H,17,18)
InChIKeyKGPMYOQASOSJRS-UHFFFAOYSA-N
MW281.31 g/mol
LogP1.18
Rot. Bonds7

About 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid

3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid (PubChem CID 119362723) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid.

Molecular Properties

Compound Name3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid
PubChem CID119362723
Molecular FormulaC14H19NO5
Molecular Weight281.31 g/mol
Exact Mass281.13
IUPAC Name3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid
SMILESCOc1cccc(OC)c1CC(=O)N(C)CCC(=O)O
InChIInChI=1S/C14H19NO5/c1-15(8-7-14(17)18)13(16)9-10-11(19-2)5-4-6-12(10)20-3/h4-6H,7-9H2,1-3H3,(H,17,18)
InChIKeyKGPMYOQASOSJRS-UHFFFAOYSA-N
XLogP1.18
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.31
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid?
The IUPAC name of 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid (CID 119362723) is 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid.
What is the SMILES notation for 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid?
The canonical SMILES for 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid is COc1cccc(OC)c1CC(=O)N(C)CCC(=O)O.
What is the InChIKey of 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid?
The InChIKey is KGPMYOQASOSJRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO5/c1-15(8-7-14(17)18)13(16)9-10-11(19-2)5-4-6-12(10)20-3/h4-6H,7-9H2,1-3H3,(H,17,18).
What are the key properties of 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid?
3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid has a molecular weight of 281.31 g/mol, XLogP of 1.18, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2,6-dimethoxyphenyl)acetyl]-methylamino]propanoic acid is sourced from PubChem (CID 119362723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).