C17H23NO4 — CID 119366510
(2S)-2-[3-(oxan-4-yl)propanoylamino]-3-phenylpropanoic acid (PubChem CID 119366510) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (2S)-2-[3-(oxan-4-yl)propanoylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[3-(oxan-4-yl)propanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119366510 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2S)-2-[3-(oxan-4-yl)propanoylamino]-3-phenylpropanoic acid |
| SMILES | O=C(CCC1CCOCC1)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H23NO4/c19-16(7-6-13-8-10-22-11-9-13)18-15(17(20)21)12-14-4-2-1-3-5-14/h1-5,13,15H,6-12H2,(H,18,19)(H,20,21)/t15-/m0/s1 |
| InChIKey | ISXQBSMHEKIYOX-HNNXBMFYSA-N |
| XLogP | 2.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |