C20H24N4O4 — CID 119367660
(2R)-2-[[1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carbonyl]amino]-2-phenylacetic acid (PubChem CID 119367660) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is (2R)-2-[[1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 119367660 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2R)-2-[[1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carbonyl]amino]-2-phenylacetic acid |
| SMILES | O=C(Cn1cc(C(=O)N[C@@H](C(=O)O)c2ccccc2)cn1)NC1CCCCC1 |
| InChI | InChI=1S/C20H24N4O4/c25-17(22-16-9-5-2-6-10-16)13-24-12-15(11-21-24)19(26)23-18(20(27)28)14-7-3-1-4-8-14/h1,3-4,7-8,11-12,16,18H,2,5-6,9-10,13H2,(H,22,25)(H,23,26)(H,27,28)/t18-/m1/s1 |
| InChIKey | DLILFVJCRIYPGS-GOSISDBHSA-N |
| XLogP | 1.89 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |