C14H17N3O3 — CID 119369476
(2R)-3-methyl-2-[(5-methyl-1H-indazole-7-carbonyl)amino]butanoic acid (PubChem CID 119369476) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2R)-3-methyl-2-[(5-methyl-1H-indazole-7-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[(5-methyl-1H-indazole-7-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 119369476 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2R)-3-methyl-2-[(5-methyl-1H-indazole-7-carbonyl)amino]butanoic acid |
| SMILES | Cc1cc(C(=O)N[C@@H](C(=O)O)C(C)C)c2[nH]ncc2c1 |
| InChI | InChI=1S/C14H17N3O3/c1-7(2)11(14(19)20)16-13(18)10-5-8(3)4-9-6-15-17-12(9)10/h4-7,11H,1-3H3,(H,15,17)(H,16,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | GBPZESFCJMOBPL-LLVKDONJSA-N |
| XLogP | 1.71 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |