C14H16ClN3O3 — CID 146187845
ethyl 3-[(5-chloro-1H-indazole-7-carbonyl)amino]butanoate (PubChem CID 146187845) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is ethyl 3-[(5-chloro-1H-indazole-7-carbonyl)amino]butanoate.
| Compound Name | ethyl 3-[(5-chloro-1H-indazole-7-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 146187845 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | ethyl 3-[(5-chloro-1H-indazole-7-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)CC(C)NC(=O)c1cc(Cl)cc2cn[nH]c12 |
| InChI | InChI=1S/C14H16ClN3O3/c1-3-21-12(19)4-8(2)17-14(20)11-6-10(15)5-9-7-16-18-13(9)11/h5-8H,3-4H2,1-2H3,(H,16,18)(H,17,20) |
| InChIKey | PFOQGVNDZIPWLW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |