C20H21NO3 — CID 119370153
(2R)-2-[4-(9H-fluoren-3-yl)butanoylamino]propanoic acid (PubChem CID 119370153) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2R)-2-[4-(9H-fluoren-3-yl)butanoylamino]propanoic acid.
| Compound Name | (2R)-2-[4-(9H-fluoren-3-yl)butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119370153 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2R)-2-[4-(9H-fluoren-3-yl)butanoylamino]propanoic acid |
| SMILES | C[C@@H](NC(=O)CCCc1ccc2c(c1)-c1ccccc1C2)C(=O)O |
| InChI | InChI=1S/C20H21NO3/c1-13(20(23)24)21-19(22)8-4-5-14-9-10-16-12-15-6-2-3-7-17(15)18(16)11-14/h2-3,6-7,9-11,13H,4-5,8,12H2,1H3,(H,21,22)(H,23,24)/t13-/m1/s1 |
| InChIKey | DTXFRZKCWKANPD-CYBMUJFWSA-N |
| XLogP | 3.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |