C15H19NO4S — CID 119371042
(2R)-1-[3-(4-methoxyphenyl)sulfanylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119371042) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2R)-1-[3-(4-methoxyphenyl)sulfanylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-(4-methoxyphenyl)sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119371042 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2R)-1-[3-(4-methoxyphenyl)sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(SCCC(=O)N2CCC[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-20-11-4-6-12(7-5-11)21-10-8-14(17)16-9-2-3-13(16)15(18)19/h4-7,13H,2-3,8-10H2,1H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | JIEVRSRGFPZHDT-CYBMUJFWSA-N |
| XLogP | 2.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |