C21H24FNO2S — CID 55805360
1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)sulfanylpropan-1-one (PubChem CID 55805360) has the molecular formula C21H24FNO2S and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)sulfanylpropan-1-one.
| Compound Name | 1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 55805360 |
| Molecular Formula | C21H24FNO2S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[2-[(3-fluorophenyl)methyl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)sulfanylpropan-1-one |
| SMILES | COc1ccc(SCCC(=O)N2CCCC2Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H24FNO2S/c1-25-19-7-9-20(10-8-19)26-13-11-21(24)23-12-3-6-18(23)15-16-4-2-5-17(22)14-16/h2,4-5,7-10,14,18H,3,6,11-13,15H2,1H3 |
| InChIKey | VDSQCJNXMQLSSM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |