C19H19BrFNO — CID 47079509
1-[2-[(4-bromophenyl)methyl]pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone (PubChem CID 47079509) has the molecular formula C19H19BrFNO and a molecular weight of 376.27 g/mol. Its IUPAC name is 1-[2-[(4-bromophenyl)methyl]pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-[2-[(4-bromophenyl)methyl]pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 47079509 |
| Molecular Formula | C19H19BrFNO |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-[2-[(4-bromophenyl)methyl]pyrrolidin-1-yl]-2-(3-fluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCCC1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrFNO/c20-16-8-6-14(7-9-16)12-18-5-2-10-22(18)19(23)13-15-3-1-4-17(21)11-15/h1,3-4,6-9,11,18H,2,5,10,12-13H2 |
| InChIKey | CUHOURVIJZQNOT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |